Bunaftin

A Wikipédiából, a szabad enciklopédiából
Bunaftine.svg
Bunaftin
IUPAC-név
N-[2-(dietilamino)etil]-N-propilnaftalin-1-karboxamid
Kémiai azonosítók
CAS-szám 32421-46-8
PubChem 36131
ChemSpider 33233
KEGG D07428
ATC kód C01BD03
Gyógyszer szabadnév bunaftine
SMILES
O=C(N(CCCC)CCN(CC)CC)c2cccc1ccccc12
InChI
1/C21H30N2O/c1-4-7-15-23(17-16-22(5-2)6-3)21(24)
20-14-10-12-18-11-8-9-13-19(18)20/
h8-14H,4-7,15-17H2,1-3H3
StdInChIKey WWGZXRYELYWJBD-UHFFFAOYSA-N
UNII GH09PRQ3FU
Kémiai és fizikai tulajdonságok
Kémiai képlet C21H30N2O
Moláris tömeg 326,48 g/mol

A bunaftin a szívritmuszavar elleni szerek III. osztályába tartozó gyógyszer. Meghosszabbítja a szívizom nyugalmi állapotát és stabilizálja a sejtfalakat.

Készítmények[1][szerkesztés]

  • Meregon (hidroklorid és citrát formában)

Magyarországon nincs forgalomban.[2]

Jegyzetek[szerkesztés]

  1. Bunaftine (Drugs-About.com)
  2. Az OGYI adatbázisában még a hatóanyag sem szerepel.

Kapcsolódó szócikkek[szerkesztés]

Ez a szócikk részben vagy egészben a Bunaftine című angol Wikipédia-szócikk fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel.