Imiprotrin

A Wikipédiából, a szabad enciklopédiából
Imiprotrin[1][2]
Imiprothrin.svg
IUPAC-név (2,5-Dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate
Más nevek Pralle; Multicide
Kémiai azonosítók
CAS-szám 72963-72-5
PubChem 123622
ChemSpider 11677252
SMILES
O=C2N(OC(=O)C1C(/C=C(\C)C)C1(C)C)C(=O)CN2CC#C
InChI
1/C16H20N2O4/c1-6-7-17-9-12(19)18(15(17)21)22-14(20)
13-11(8-10(2)3)16(13,4)5/h1,8,11,13H,7,9H2,2-5H3
StdInChIKey LCSQQWBCNOLPHM-UHFFFAOYSA-N
Kémiai és fizikai tulajdonságok
Kémiai képlet C17H22N2O4
Moláris tömeg 318,37 g/mol
Megjelenés aranysárga, édes szagú folyadék
Sűrűség 0.979 g/mL
Veszélyek
R mondatok R22 R50
S mondatok S61
Lobbanáspont 110 °C
Ha másként nem jelöljük, az adatok
az anyag standard állapotára vonatkoznak.
(25 °C, 100 kPa)

Az imiprotrin (imiprothrin) egy piretroid alapú rovarölő szer, számos beltéri rovarirtó egyik összetevője. Az emberekre nézve alacsony veszélyességű, rovaroknál azonban paralízist okozó neurotoxinként viselkedik.

Források[szerkesztés]