Fenotrin

A Wikipédiából, a szabad enciklopédiából
Fenotrin
Sumithrin-2D-skeletal.png
IUPAC-név (3-Fenoxifenil)metil 2,2-dimetil-3-(2-metilprop-1-enil)ciklopropán-1-karboxilát
Más nevek Sumithrin
Phenothrine
Phenoxythrin
Sumitrin
Wellcide
Pibutin
Anvil
Duet
Anchimanaito 20S
Kémiai azonosítók
CAS-szám 26002-80-2
PubChem 4767
ChemSpider 4603
EINECS-szám 247-404-5
KEGG D08357
MeSH Phenothrin
ChEBI 34916
ATC kód P03AC03, QP53AC03
Gyógyszer szabadnév phenothrin
SMILES
O=C(OCc2cccc(Oc1ccccc1)c2) C3C(/C=C(/C)C)C3(C)C
InChI
1/C23H26O3/c1-16(2)13-20-21(23(20,3)4)22(24) 25-15-17-9-8-12-19(14-17)26-18-10-6-5-7-11-18/ h5-14,20-21H,15H2,1-4H3
StdInChIKey SBNFWQZLDJGRLK-UHFFFAOYSA-N
UNII 707484X33X
ChEMBL 1322884
Kémiai és fizikai tulajdonságok
Kémiai képlet C23H26O3
Moláris tömeg 350,451 g/mol
Olvadáspont <25 °C
Forráspont >290 °C
Veszélyek
R mondatok R36 R38
Ha másként nem jelöljük, az adatok
az anyag standard állapotára vonatkoznak.
(25 °C, 100 kPa)

A fenotrin halványsárga, sárga vagy barna, szintetikusan előállított folyadék. Vízben rosszul oldódik.

Általános rovarirtó. Emberi hajtetű ellen,[1][2] háztartási rovarirtóként,[3][4][5] kutyabolha ellen. Korábban a mezőgazdaságban rovarirtó permetszerekben[6] használták, de 2003 óta az EU-ban, és így Magyarországon is tiltott mint növényvédőszer.

Készítmények[szerkesztés]

Számos önálló és a fenotrint kombinációban tartalmazó készítmény van a nemzetközi forgalomban.[7]

Magyarországon nincs gyógyszertári forgalomban fenotrint tartalmazó készítmény,[8] de számos vény nélkül kapható termék tartalmaz fenotrint.

Jegyzetek[szerkesztés]

  1. Pedex hajszesz (Arcanum WebPatika)
  2. PARASIDOSE SAMPON Betegtájékoztató
  3. CATCH CHEMOTOX Hangyairtó csalétek (Biztonsági adatlap)
  4. Mortein Légy- és szúnyogirtó aeroszol (Biztonsági adatlap)
  5. Vape Sanity házi poratkairtó aerosol (Arcanum WebPatika)
  6. Oláh Eszter: Piretroidok (Környezetvédelmi információ)
  7. Phenothrin (Drugs-About.com)
  8. Phenothrin (OGYI)

Források[szerkesztés]

További információk[szerkesztés]

Kapcsolódó szócikkek[szerkesztés]