Adenozin-difoszfát

A Wikipédiából, a szabad enciklopédiából
Adenozin-difoszfát
Adenosindiphosphat protoniert.svg
Kémiai azonosítók
CAS-szám 58-64-0
PubChem 197
SMILES
Nc1ncnc2[n](cnc12)[C@@H]3O[C@H]
(COP([O-])(=O)OP(O)([O-])=O)C(O)C3O
Kémiai és fizikai tulajdonságok
Kémiai képlet C10H15N5O10P2
Moláris tömeg 427,201 g/mol
Ha másként nem jelöljük, az adatok
az anyag standard állapotára vonatkoznak.
(25 °C, 100 kPa)

Az adenozin-difoszfát, röviden ADP egy nukleotid. A pirofoszforsav és az adenin nukleotid észtere. Egy pirofoszfát, egy ribóz (pentóz cukor) és egy adenin bázisrészből épül fel.