Benzalkónium-klorid

A Wikipédiából, a szabad enciklopédiából
Benzalkónium-klorid
Benzalkonium chloride Structure V.1.svg
Más nevek N-alkil-N-benzil-N,N-dimetilammónium-klorid, alkildimetilbenzilammónium-klorid
Moláris tömeg (keverék)
CAS-szám [8001-54-5]
EINECS-szám 264-151-6
SMILES [Cl-].C[N+](C)(C)Cc1ccccc1
InChI InChI=InChI=1/C10H16N.ClH/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H/q+1;/p-1
Kémiai és fizikai tulajdonságok
Sűrűség 0,98 g/cm³
Olvadáspont 29–34 °C[2]
Oldhatóság (vízben) 4000 g/l (20 °C)[2]
Veszélyek
EU osztályozás Maró (C)
Veszélyes a környezetre (N)[2]
R mondatok R21/22, R34, R50[2]
S mondatok (S2), S36/37/39, S45, S61[2]
LD50 240 mg/kg (patkány, szájon át)[2]
Ha másként nem jelöljük, az adatok
az anyag standard állapotára vonatkoznak.
(25 °C, 100 kPa)

A benzalkónium-klorid (INN: benzalkonium chloride) (alkil-dimetil-benzil-ammónium-klorid) eltérő hosszúságú alkilcsoportokat tartalmazó alkil-benzil-dimetil-ammónium kloridok keveréke. Általában antiszeptikumnak vagy spermicid anyagnak használják. A VIII. Magyar Gyógyszerkönyvben Benzalkonii chloridum néven hivatalos.

Kémia[szerkesztés | forrásszöveg szerkesztése]

Az anyag a kvaterner ammóniumvegyületek csoportjába tartozik és kationos felületaktív hatása is van. A C12-C14 alkilhosszúságú változatai mutatják a legerősebb antibakteriális hatást.

Források[szerkesztés | forrásszöveg szerkesztése]

  1. http://www.ogyi.hu/dynamic/Benzalkonii_chloridum.pdf
  2. ^ a b c d e f A benzalkónium-klorid vegyülethez tartozó bejegyzés az IFA GESTIS adatbázisából. A hozzáférés dátuma: 2011. január 12. (JavaScript szükséges) (németül)