Metoklopramid

A Wikipédiából, a szabad enciklopédiából
Ugrás a navigációhoz Ugrás a kereséshez
Metoclopramide.svg
Metoclopramide 3D.png
Metoklopramid
IUPAC-név
4-amino-5-klór-N-(2-(dietilamino)etil)-
2-metoxibenzamid
Kémiai azonosítók
CAS-szám 364-62-5
PubChem 4168
ChemSpider 4024
DrugBank APRD00665
ATC kód A03FA01
SMILES
Clc1cc(c(OC)cc1N)C(=O)NCCN(CC)CC
UNII L4YEB44I46
Kémiai és fizikai tulajdonságok
Kémiai képlet C14H22ClN3O2
Moláris tömeg 299,80 g/mol
Farmakokinetikai adatok
Biohasznosíthatóság 80±15% (orális)
Metabolizmus Máj
Biológiai
felezési idő
5–6 óra
Kiválasztás 70–85% renal, 2% faecal
Terápiás előírások
Jogi státusz S3/S4 (Au), POM (UK), ℞-only (U.S.) (HU)
Terhességi kategória A (Au), B (U.S.)
Alkalmazás Oral, IV, IM

A metoklopramid centrális támadáspontú dopamin antagonista. Ezen kívül perifériás kolinerg hatása is van. Két fő hatás különböztethető meg: antiemetikus hatás, a gyomorkiürülést és a vékonybélpasszázst gyorsító hatás.

Hatása[szerkesztés]

Az antiemetikus hatását az agytörzsben (a hányásközpont kemoreceptor trigger zónájában) centrális támadásponton keresztül, feltehetően a dopaminerg neuronok ingerküszöbének emelésével fejti ki. A megnövekedett motilitás részben szintén a központi centrumok irányítása alatt áll, ugyanakkor a perifériás hatásmechanizmus a posztganglionáris kolinerg receptorok aktiválásán keresztül és valószínűleg a gyomor és bél dopaminerg receptorainak gátlásán keresztül játszik szerepet. A nemkívánatos hatás főként extrapiramidális tüneteket foglal magába (akaratlan spasztikus mozgás), amit a dopamin receptor blokkoló hatás idéz elő. Hosszan tartó alkalmazás esetén a prolaktin szekréció gátlásának hiányában a prolaktin szérumkoncentrációja megnövekedhet. Nőknél galactorrhoeát és menstruációs zavarokat, férfiaknál gynaecomastiát írtak le. A gyógyszer szedésének felfüggesztését követően ezek megszűnnek.

Jegyzetek[szerkesztés]

Ez a szócikk részben vagy egészben a Metoclopramide című angol Wikipédia-szócikk fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel.