Lanoszterin

A Wikipédiából, a szabad enciklopédiából
Jump to navigation Jump to search
Lanoszterin
Lanosterol skeletal.svg
IUPAC-név (3β)-lanosta-8,24-dién-3-ol[1]
Szabályos név (3β,5α)-4,4,14-trimetil-koleszta-8,24-dién-3-ol,
(3S,5R,10S,13R,14R,17R)-4,4,10,13,14-pentametil-17-[(2R)-6-metil-5-heptén-2-il]-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradekahidro-1H-ciklopenta[a]fenantrén-3-ol
Más nevek kriptoszterin
Kémiai azonosítók
CAS-szám 79-63-0
PubChem 46936757
ChemSpider 216175
EINECS-szám 218-141-3
DrugBank DB03696
KEGG C01724
ChEBI 16521
SMILES
C[C@@H]([C@@H]1[C@@]2([C@](C3=C([C@@]4([C@H]([C@@]([C@H](CC4)O)(C)C)CC3)C)CC2)(CC1)C)C)CCC=C(C)C
InChI
1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8) 24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24) 15-19-29(22,30)7/h10,21-22,25-26,31H,9,11-19H2, 1-8H3/t21-,22-,25+,26+,28-,29-,30+/m1/s1
Beilstein 2226449
Kémiai és fizikai tulajdonságok
Kémiai képlet C30H50O
Moláris tömeg 426,72 g/mol
Megjelenés fehér por
Olvadáspont 137 °C
Oldószerei kloroform, etanol
Veszélyek
MSDS Sigma-Aldrich
Rokon vegyületek
Rokon vegyületek lanosztán(en) (alapvegyület)
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

A lanoszterin négy gyűrűből álló triterpenoid és hidroxiszteroid. E vegyületből állítja elő a szervezet a többi szteroidot, első lépésben a koleszterint.

Nevét onnan kapta, hogy legnagyobb mennyiségben a lanolinban (gyapjúzsírban) fordul elő.

Bioszintézis[szerkesztés]

Szkvalénból keletkezik epoxiszkvalénon keresztül a lanoszterin szintáz enzim hatására.[2] A szkvalén triterpén, azaz 6 izoprén egységből álló szénhidrogén (a terpén két izoprénből áll).

Szkvalén(en). A kék pontok az izoprén-határokat jelzik.
Nyille.svg szkvalén-monooxigenáz(en)
Szkvalén-2,3-epoxid(en). A pirossal jelölt kötések a zöld ponttal jelöltekre változnak, amikor a szkvalén-2,3-epoxid átalakul lanoszterinné. A két pirossal jelölt atom hidrogéndonor, a két zöld hidrogén akceptor az átalakulás során.
Nyille.svg lanoszterin szintáz(en)
Lanoszterin
Nyille.svg NADPH(en) + H+
NADH + H+
O2

Reakciók[szerkesztés]

  • 24,25-dihidrolanoszterin[3] keletkezik belőle (az oldallánc kettős kötése telítődik) a delta24-szterol reduktáz(en) enzim hatására[4]
  • 4,4-dimetil-5α-koleszta-8,14,24-trién-3β-ol-lá[5] alakul át (a ciklopentán gyűrűben kettős kötés keletkezik, miközben az egyik metil-gyök leválik róla) a szterol-14 demetiláz(en) enzim hatására[6]

Jegyzetek[szerkesztés]

  1. Lásd 3S-1 The Nomenclature of Steroids Recommendations 1989 (IUPAC)
  2. REACTION: R03199 (KEGG)
  3. Lanost-8-en-3β-ol (ChemSpider)
  4. REACTION: R03689 (KEGG)
  5. 4,4-dimethyl-5α-cholesta-8,14,24-trien-3β-ol (ChemSpider)
  6. REACTION: R05640 (KEGG)

Források[szerkesztés]

Kémiai/fizikai tulajdonságok: