Kreatin-foszfát

A Wikipédiából, a szabad enciklopédiából
Ugrás a navigációhoz Ugrás a kereséshez
Kreatin-foszfát
Creatinolfosfate.png
IUPAC-név 2-[karbamimidoil(metil)amino]etil-dihidrogén-foszfát
Más nevek Kreatinol-O-foszfát; Kreatinol-foszfát
Kémiai azonosítók
Rövidítés COP
CAS-szám 6903-79-3
PubChem 23342
ChemSpider 21827
KEGG D07162
ATC kód C01EB05
SMILES
O=P(O)(OCCN(C(=[N@H])N)C)O
InChI
1/C4H12N3O4P/c1-7(4(5)6)2-3-11-12(8,9)10/h2-3H2,1H3,(H3,5,6)(H2,8,9,10)
StdInChIKey FOIPWTMKYXWFGC-UHFFFAOYSA-N
UNII 5O564RN1QD
Kémiai és fizikai tulajdonságok
Kémiai képlet C4H12N3O4P
Moláris tömeg 197,13 g/mol
Sűrűség 1,65
Forráspont 384,1
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

A kreatin-foszfát (INN: creatinolfosfate, más néven kreatinol-O-foszfát, kreatinol-foszfát, COP) az izom és az agy egyik fontos energiahordozója. A testépítők által gyakran használt szer, mert igen gyors ütemben fokozza az izomerőt és az állóképességet. A szteroidkészítmények egyik hatása a kreatin-foszfát szintézisének fokozása. Nem minősül doppingszernek.

Az orvoslásban is használják, főleg szívbetegek támogatására.

Működésmód[szerkesztés]

Az izmok összehúzódásához szükséges energiát az ATP → ADP + Pi kémiai reakció biztosítja. Az adenozin-trifoszfát adenozin-difoszfáttá és foszfátcsoportra bomlik, miközben 30,5 kJ/mol energia szabadul fel. A szervezet azonban nem képes nagy mennyiségű ATP-t tárolni, csak annyit, amennyi „nyugalomban” kb. fél percre elég. Az energia kreatin-foszfát formájában tárolódik, melyet a szervezet a

kreatin-foszfát + ADP → kreatin + ATP

folyamattal tud mozgósítani. A reakciót a kreatin-kináz(en) enzim katalizálja, és 12,6 kJ/mol energia felvétele szükséges hozzá, melyet a szervezet szőlőcukor oxidálásával teremt elő (glikolízis). A két reakciót a sejtekben a hexokináz(en) enzim kapcsolja össze.

Szívinfarktusban a sérült szívizomsejtekből enzimek kerülnek a vérkeringésbe, ebből (is) diagnosztizálható az infarktus. A kreatin-kináz a diagnosztizálásra használt enzimek egyike.[1]

Az izomsejtekben felgyülemlett kreatin-foszfát elsődleges hatása az, hogy elnyújtsa az anaerob glikolízis energiatermelő folyamatot az egyre fölszaporodó tejsav jelenlétében is.[2] Emellett csökkenti az oxigénigényt edzés alatt, valamint növeli az izmok „energia valutájának”, az ATP-nek a szintjét.

Bioszintézis[szerkesztés]

A szervezet három lépésben állítja elő.

  1. a vesében argininből és glicinből a transzaminidáz[3] enzim közreműködésével guanidino-acetát(en) és ornitin(en) keletkezik
  2. a májban guanidino-acetátból és S-adenozil-metioninből(en) a guanidinoacetát-metiltranszferáz(en) enzim hatására kreatin és S-adenozil-homocisztein(en) áll elő
  3. kreatinból a feljebb már említett reakció megfordításával keletkezik a kreatin-foszfát.

A kreatin az izomban nem-enzimatikus reakcióval gyűrűvé záródhat. Az így képződő kreatinint(en) a vese választja ki. A kiválasztás jól felhasználható a vesefunkció vizsgálatára.

Készítmények[4][szerkesztés]

  • Aplodan
  • Dragosil
  • Gipron

Magyarországon nincs gyógyszertári forgalomban.

Jegyzetek[szerkesztés]

  1. A szárazdiagnosztika alapjai; a szívizom infarktus biokémiai háttere és laboratóriumi diagnosztikája Archiválva 2007. augusztus 8-i dátummal a Wayback Machine-ben (Oktatási segédanyag orvostanhallgatók részére)
  2. Anaerob, azaz oxigénhiányos környezetben a szőlőcukor nem piroszőlősavvá, hanem tejsavvá oxidálódik, ehhez ui. kevesebb oxigén kell, viszont kevesebb energia szabadul fel.
  3. Glycine aminidotransferase (Google könyvek)
  4. Creatinolfosfate (Drugs-About.com)

Források[szerkesztés]

Kapcsolódó szócikkek[szerkesztés]