Ugrás a tartalomhoz

1,2-Dinitrobenzol

A Wikipédiából, a szabad enciklopédiából
1,2-Dinitrobenzol
Kémiai azonosítók
CAS-szám 528-29-0
PubChem 10707
ChemSpider 10257
RTECS szám CZ7450000
SMILES
C1=CC=C(C(=C1)[N+](=O)[O-])[N+](=O)[O-]
InChIKey IZUKQUVSCNEFMJ-UHFFFAOYSA-N
UNII 35XUO924Y0
ChEMBL 168075
Kémiai és fizikai tulajdonságok
Kémiai képlet C6H4N2O4
Moláris tömeg 168,11 g/mol
Megjelenés fehér, szilárd anyag
Sűrűség 1,565 g/cm3
Olvadáspont 118 °C
Forráspont 318 °C
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

Az 1,2-dinitrobenzol szerves vegyület, egyike a három dinitrobenzol izomernek, képlete C6H4(NO2)2. Fehér vagy színtelen szilárd anyag, szerves oldószerekben oldódik. 2-nitroanilinból állítják elő diazotálással, majd nátrium-nitrites kezeléssel réz katalizázor jelenlétében.[1]

Jegyzetek

[szerkesztés]
  1. E. B. Starkey (1939). „p-Dinitrobenzene”. Org. Synth. 19, 40. o. DOI:10.15227/orgsyn.019.0040.  

Fordítás

[szerkesztés]

Ez a szócikk részben vagy egészben a(z) 1,2-Dinitrobenzene című angol Wikipédia-szócikk ezen változatának fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel. Ez a jelzés csupán a megfogalmazás eredetét és a szerzői jogokat jelzi, nem szolgál a cikkben szereplő információk forrásmegjelöléseként.