Karumonám

A Wikipédiából, a szabad enciklopédiából
Ugrás a navigációhoz Ugrás a kereséshez
Carumonam.png
Karumonám
IUPAC-név
2-[[1-(2-amino-1,3-tiazol-4-il)-2-[[(2S,3S)-2-(karbamoiloximetil)-4-oxo-1-szulfoazetidin-3-il]amino]-2-oxoetilidén]amino]oxiecetsav
Kémiai azonosítók
CAS-szám 87638-04-8
PubChem 6857983
ChemSpider 5257278
ATC kód J01DF02
Gyógyszer szabadnév carumonam
SMILES
O=S(=O)(O)N2C(=O)[C@@H](NC(=O)C(=N\OCC(=O)O)\c1nc(sc1)N)[C@H]2COC(=O)N
InChI
1/C12H14N6O10S2/c13-11-15-4(3-29-11)7(17-28-2-6(19)20)9(21) 16-8-5(1-27-12(14)
23)18(10(8)22)30(24,25)26/h3,5,8H,1-2H2,(H2,13,15)(H2,14,23)(H,16,21)(H,19,20)(H,24,25,26)/b17-7+/t5-,8+/m1/s1
StdInChIKey UIMOJFJSJSIGLV-PDWQJGMQSA-N
UNII 486890PI06
ChEMBL 1256767
Kémiai és fizikai tulajdonságok
Kémiai képlet C12H14N6O10S2
Moláris tömeg 466,40 g/mol

A karumonám (AMA-1080) monobaktám típusú antibiotikum, a Pseudomonas acidophila(en) baktérium által előállított szulfazecin[1] szintetikus származéka. Igen hatásos a legtöbb Gram-negatív baktérium ellen, pl. Enterobacteriaceae, Pseudomonas aeruginosa(en) és Haemophilus influenzae(en), kivéve a Staphylococcus aureust és a Bacteroides fragilist(en). 19-féle β-laktamáz(en) enzimnek áll ellen, vagyis a baktériumok nehezen válnak rezisztenssé a karumonámmal szemben.

Fizikai/kémiai tulajdonságok[szerkesztés]

Színtelen por.[2] LD50 értéke szájon át:[3]

  • egér: 300 mg/tskg
  • nyúl: 3200 mg/tskg
  • patkány: 980 mg/tskg.

Készítmények[szerkesztés]

A nemzetközi gyógyszerkereskedelemben:[4]

  • Amasulin

Magyarországon nincs forgalomban.[5]

Jegyzetek[szerkesztés]

  1. Sulfazecin (PubChem)
  2. Carumonam (DrugFuture.com)
  3. CARUMONAM[halott link] (Clearsynth, MSDS)
  4. Carumonam (Drugs-About.com)
  5. Az OGYI adatbázisában még a hatóanyag sem szerepel.

Források[szerkesztés]

További információk[szerkesztés]

Kapcsolódó szócikkek[szerkesztés]