Etiléntetrakarbonsav-dianhidrid

A Wikipédiából, a szabad enciklopédiából
Etiléntetrakarbonsav-dianhidrid
Ethylenetetracarboxylic dianhydride.png
IUPAC-név Furo[3,4-c]furán-1,3,4,6-tetraon
Kémiai azonosítók
CAS-szám 15016-12-3
SMILES
O=C(C(C(O2)=O)=C1C2=O)OC1=O
Kémiai és fizikai tulajdonságok
Kémiai képlet C6O6
Moláris tömeg 168,06 g/mol
Ha másként nem jelöljük, az adatok
az anyag standard állapotára vonatkoznak.
(25 °C, 100 kPa)

Az etiléntetrakarbonsav-dianhidrid halványsárga olajszerű folyadék, mely oldható di- és triklórmetánban. A szén egyik oxidja.

Szerkezetileg felfogható mint két kondenzált maleinsav-anhidrid(en) gyűrű.

1981-ben Patterson szintetizálta munkatársaival etilén-tetrakarbonsav pirolízisével. 2009-ben Taherpour újszerű és ígéretesnek tűnő eljárással, szilárd Meldrum-sav mikrohullámú pirolízisével állította elő.

További információk[szerkesztés]

Kapcsolódó szócikkek[szerkesztés]

Fordítás[szerkesztés]

Ez a szócikk részben vagy egészben az Ethylenetetracarboxylic dianhydride című angol Wikipédia-szócikk fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel.