Ugrás a tartalomhoz

Benzoesav-anhidrid

A Wikipédiából, a szabad enciklopédiából
Benzoesav-anhidrid[1]
Más nevek benzoil-benzoát
Kémiai azonosítók
CAS-szám 93-97-0
PubChem 7167
ChemSpider 6899
EINECS-szám 202-291-1
SMILES
c1ccc(cc1)C(=O)OC(=O)c2ccccc2
InChIKey CHIHQLCVLOXUJW-UHFFFAOYSA-N
Beilstein 516726
Kémiai és fizikai tulajdonságok
Kémiai képlet C14H10O3
Moláris tömeg 226,23 g mol−1
Megjelenés fehér vagy törtfehér, szilárd anyag
Sűrűség 1,1989 g cm−3 (15 °C)
Olvadáspont 42 °C
Forráspont 360 °C
Mágneses szuszceptibilitás −124,9·10−6 cm3/mol
Veszélyek
NFPA 704
2
1
1
 
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

A benzoesav-anhidrid szerves vegyület, képlete (C6H5CO)2O. A benzoesav savanhidridje, a legegyszerűbb szimmetrikus aromás savanhidrid. Fehér színű szilárd anyag.

Előállítása és reakciói

[szerkesztés]

Általában benzoesavból állítják elő vízelvonással, például ecetsav-anhidrid felhasználásával:[3]

2 C6H5CO2H + (CH3CO)2O → (C6H5CO)2O + 2 CH3CO2H

További lehetőség a nátrium-benzoát benzoil-kloriddal történő kezelése, de a benzoesav hő hatására történő dehidratációjával is előállítható.

Felhasználható a benzoesav észtereinek kényelmes előállításához:

(C6H5CO)2O + ROH → C6H5CO2H + C6H5CO2R

Jegyzetek

[szerkesztés]
  1. Sciencelab msds. [2016. március 4-i dátummal az eredetiből archiválva]. (Hozzáférés: 2019. december 30.)
  2. aldrich product page
  3. (1923) „Benzoic Anhydride”. Org. Synth. 3, 21. o. DOI:10.15227/orgsyn.003.0021.  

Fordítás

[szerkesztés]

Ez a szócikk részben vagy egészben a Benzoic anhydride című angol Wikipédia-szócikk ezen változatának fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel. Ez a jelzés csupán a megfogalmazás eredetét és a szerzői jogokat jelzi, nem szolgál a cikkben szereplő információk forrásmegjelöléseként.