Proximetakain

A Wikipédiából, a szabad enciklopédiából
Jump to navigation Jump to search
Proxymetacaine structure.svg
Proximetakain
IUPAC-név
2-(dietilamino)etil 3-amino-4-propoxibenzoát
Kémiai azonosítók
CAS-szám 499-67-2, 5875-06-9 (hidroklorid)
PubChem 4935
ChemSpider 4766
DrugBank APRD00522
KEGG D08448
ATC kód S01HA04
Gyógyszer szabadnév proxymetacaine
SMILES
O=C(OCCN(CC)CC)c1ccc(OCCC)c(c1)N
InChI
1/C16H26N2O3/ c1-4-10-20-15-8-7-13(12-14(15)17) 16(19)21-11-9-18(5-2)6-3/ h7-8,12H,4-6,9-11,17H2,1-3H3
StdInChIKey KCLANYCVBBTKTO-UHFFFAOYSA-N
UNII B4OB0JHI1X
ChEMBL 1196
Kémiai és fizikai tulajdonságok
Kémiai képlet C16H26N2O3
Moláris tömeg 294,39 g/mol
Sűrűség 1,065
Olvadáspont 182–183,3 °C
Farmakokinetikai adatok
Metabolizmus Plasma
Terápiás előírások
Terhességi kategória C (US)
Alkalmazás helyi (szemcsepp)

A proximetakain (USAN:[1] proparacaine) aminoészter típusú helyi érzéstelenítő. Szemcsepp formájában alkalmazzák szemnyomás mérésekor (tonometria[2]), a csarnokzug vizsgálatakor (gonioszkópia,[3] idegen test eltávolításakor a kötőhártyából vagy a szaruhártyából, és más rövid idejű érzéstelenítést igénylő beavatkozáskor.

Nagyon gyorsan (20 másodpercen belül) hat, és a hatása legalább 15 percig fennmarad.

Hatásmód[szerkesztés]

A feszültségcsatolt nátriumcsatornákat gátolja, amivel az idegsejtek falának átjárhatóságát, ezzel pedig a fájdalominger továbbítását akadályozza. A fájdalomcsillapítás pontos mechanizmusa nem ismert.

Más szereknél kevésbé csípi a szemet a becsöppentéskor. Átmenetileg homályos látást okozhat, és ez a gépjárművezetést is akadályozhatja. Mint minden fájdalomcsillapító, tartós használata a szem károsodását okozhatja.

Jelentős mennyiségben alkalmazva a központi idegrendszerre és a szívre először serkentő, később depresszív hatása van.

Készítmények[szerkesztés]

Magyarországon nincs forgalomban proximetakain-tartalmú készítmény,[4] de a nemzetközi gyógyszerkereskedelem számos készítményt kínál.[5]

Jegyzetek[szerkesztés]

  1. Az Egyesült Államokban elfogadott gyógyszer szabadnév. Lásd: United States Adopted Name (angol Wikipédia).
  2. Lásd pl. Glaukóma (zöld hályog) (Házipatika.com).
  3. Lásd pl. Szemfenéki thrombózisok (Budapest Retina Associates).
  4. proxymetacaine (OGYI).
  5. Proparacaine (Drugs-About.com).

Források[szerkesztés]

További információk[szerkesztés]

Kapcsolódó szócikkek[szerkesztés]