Nalidixsav

A Wikipédiából, a szabad enciklopédiából
Ugrás a navigációhoz Ugrás a kereséshez
Nalidixic acid.png
Nalidixsav
IUPAC-név
1-etil-7-metil-4-oxo-1,8-naftiridin-3-karbonsav
Kémiai azonosítók
CAS-szám 389-08-2
PubChem 4421
ChemSpider 4268
DrugBank APRD01133
ATC kód J01MB02
Gyógyszer szabadnév nalidixic acid
Gyógyszerkönyvi név Acidum nalidixicum
SMILES
CCn1cc(c(=O)c2c1nc(cc2)C)C(=O)O
InChI
1S/C12H12N2O3/c1-3-14-6-9(12(16)17)10(15)8-5-4-7(2)13-11(8)14/h4-6H,3H2,1-2H3,(H,16,17)
StdInChIKey MHWLWQUZZRMNGJ-UHFFFAOYSA-N
Kémiai és fizikai tulajdonságok
Kémiai képlet C12H12N2O3
Moláris tömeg 232,24 g/mol
Farmakokinetikai adatok
Metabolizmus Részben máj
Biológiai
felezési idő
6-7 óra, szignifikánsan hosszabb vesekárosodás esetén
Terápiás előírások
Terhességi kategória B U.S.
Alkalmazás Oral

A nalidixsav a kinolon, fluorokinolon típusú antibiotikumok alapvegyülete. A modernebb származékok szinte teljesen kiszorították a terápiából. Egyes húgyúti fertőzések kezelésére még alkalmazzák (például Escherichia coli, Proteus, Shigella, Enterobacter és Klebsiella fajok ellen l.Enterobacteriaceae). A nalidixsav kisebb koncentrációban bakteriosztatikus, azaz a kórokozókat nem öli meg, csak növekedésüket, szaporodásukat gátolja; nagyobb koncentrációban baktericid, azaz halálos a baktériumokra.

Készítmények[szerkesztés]

Nevigramon