Fankinon

A Wikipédiából, a szabad enciklopédiából
Phanquinone.svg
Phanquinone-3D-balls.png
Fankinon
IUPAC-név
4,7-fenantrolin-5,6-dion
Kémiai azonosítók
CAS-szám 84-12-8
PubChem 6764
ChemSpider 6506
KEGG D07359
ChEBI 59141
ATC kód P01AX04, QP51AX03
SMILES
O=C3c1ncccc1c2c(nccc2)C3=O
InChI
1/C12H6N2O2/c15-11-9-7(3-1-5-13-9)8-4-2-6-14-10(8)12(11)16/h1-6H
StdInChIKey VLPADTBFADIFKG-UHFFFAOYSA-N
UNII ID94IS6N8J
ChEMBL 531048
Kémiai és fizikai tulajdonságok
Kémiai képlet C12H6N2O2
Moláris tömeg 210,188 g/mol
Sűrűség 1,444
Olvadáspont 295 °C
Forráspont 456,1 °C

A fankinon (INN: phanquinone) amőbiázis elleni szer.

Adagolás: napi 150–300 mg.[1]

Fizikai/kémiai tulajdonságok[szerkesztés]

Narancssárga színű, kissé keserű kristályos anyag, mely vízben kevéssé, alkoholban és kloroformban gyakorlatilag nem, híg ásványi savakban oldódik.

LD50-értéke szájon át egér esetén 4, patkány esetén 5 mg/tskg.[2]

Előállítás: 5-metoxi-4,7-fenantrolinból salétromsav és kénsav keverékében történő hevítéssel.[3]

Készítmények[szerkesztés]

A nemzetközi gyógyszerkereskedelemben:[4]

  • Enthohex
  • Entobex
  • Entronon

Magyarországon nincs forgalomban.[5]

Jegyzetek[szerkesztés]

  1. Treatment of Chronic Intestinal Amoebiasis with Entobex (cabdirect)
  2. Chemical: phanquinone (EPA)
  3. Phanquinone (Drug Synthesis)
  4. Phanquinone (medicatione)
  5. Az OGYI adatbázisában még a hatóanyag sem szerepel.

Források[szerkesztés]

További információk[szerkesztés]