Klorogén

A Wikipédiából, a szabad enciklopédiából
Ugrás a navigációhoz Ugrás a kereséshez
Chloramin B.svg
Klorogén
IUPAC-név
Nátrium-(fenilszulfonil-klórazanid)
Kémiai azonosítók
CAS-szám 127-52-6
PubChem 4347343
ChemSpider 29112
SMILES
c1ccc(cc1)S(=O)(=O)[N-]Cl.[Na+]
InChI
1S/C6H5ClNO2S.Na/c7-8-11(9,10)6-4-2-1-3-5-6;/h1-5H;/q-1;+1
StdInChIKey KDNCILYKSYKEFJ-UHFFFAOYSA-N
Kémiai és fizikai tulajdonságok
Kémiai képlet C6H5ClNNaO2S
Moláris tömeg 213,62 g/mol
Oldhatóság (vízben) ~100[1]

A klorogén vagy klóramin B vagy N-klór-benzolszulfonamid-nátriumsó szerves vegyület, fehér por vagy kristály, amely 25-27% aktív klórt tartalmaz. Tárolás közben nem bomlik. Kevésbé korrozív, csíraölő hatását 30-40 perc múlva fejti ki. A leghatásosabb savanyú közegben, ezért általában 100 liter fertőtlenítőszerhez 3 liter 10%-os sósavat adnak hozzá. Gépek, berendezések, kéz fertőtlenítéséhez használják. Savanyítva az alumíniumot korrodálja. A Neomagnol hatóanyaga.

Jegyzetek[szerkesztés]

  1. a b c Biztonságtechnikai adatlap. [2013. július 12-i dátummal az eredetiből archiválva]. (Hozzáférés: 2012. március 12.)

Források[szerkesztés]