Dillapiol

A Wikipédiából, a szabad enciklopédiából
Ugrás a navigációhoz Ugrás a kereséshez
Dillapiol
Dillapiole structure.svg
IUPAC-név 1-allil-2,3-dimetoxi-4,5-(metiléndioxi)benzol
Kémiai azonosítók
CAS-szám 484-31-1
PubChem 10231
ChemSpider 9814
KEGG C10449
SMILES
O1c2cc(c(OC)c(OC)c2OC1)CC=C
InChI
1/C12H14O4/c1-4-5-8-6-9-11(16-7-15-9)12(14-3)10(8)13-2/h4,6H,1,5,7H2,2-3H3
StdInChIKey LIKYNOPXHGPMIH-UHFFFAOYSA-N
ChEMBL 470874
Kémiai és fizikai tulajdonságok
Kémiai képlet C12H14O4
Moláris tömeg 222,24 g/mol
Sűrűség 1,163 g/cm³
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

A dillapiol illóolaj. Általában a kaporból vonják ki, de sok más növényben is megtalálható, pl.: a skóciai lestyán,[1] koriander, római kömény, édeskömény, feketecsalán, petrezselyem, kubéba-bors.[2]

Fordítás[szerkesztés]

Ez a szócikk részben vagy egészben a Dillapiole című angol Wikipédia-szócikk fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel.

Külső hivatkozások[szerkesztés]

  1. Héthelyi B. Éva, Galambosi Bertalan: Ligusticum Scoticum L. illóolaj összetételének meghatározása GC, GC/MS módszerrel Archiválva 2005. május 11-i dátummal a Wayback Machine-ben
  2. Liber Herbarum

Lásd még[szerkesztés]