Dibenz-azepin

A Wikipédiából, a szabad enciklopédiából
Dibenz-azepin
Dibenzazepine.png
IUPAC-név 5H-dibenzo[b,f]azepin
Más nevek Iminosztilbén
Kémiai azonosítók
CAS-szám 256-96-2
PubChem 9212
ChemSpider 8857
SMILES
c3cc2c(\C=C/c1c(cccc1)N2)cc3
InChI
InChI=1S/C14H11N/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)15-13/h1-10,15H
Kémiai és fizikai tulajdonságok
Kémiai képlet C14H11N
Moláris tömeg 193,24 g/mol
Megjelenés sárga–narancssárga por vagy pehely[1]
Olvadáspont 197–201°C[2]
Veszélyek
R mondatok R22 R51 R53
S mondatok S61
Ha másként nem jelöljük, az adatok
az anyag standard állapotára vonatkoznak.
(25 °C, 100 kPa)

A dibenz-azepin sárga–narancssárga por vagy pehely (op. 197–201°C).

Háromgyűrűs szekunder amin. Köztes termék fájdalomcsillapítók és skizofrénia elleni szerek előállításakor.

Telített származéka az imino-dibenzil.

Jegyzetek[szerkesztés]

  1. 5H-Dibenz[b,f]azepine: sc-239084 (Santa Cruz Biotechnology, Inc.)
  2. Iminostilbene

További információk[szerkesztés]

Kapcsolódó szócikkek[szerkesztés]

Ez a szócikk részben vagy egészben a Dibenzazepine című angol Wikipédia-szócikk fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel.