Ranunkulin

A Wikipédiából, a szabad enciklopédiából
Ranunkulin
Ranunculin skeletal.svg
IUPAC-név (2S)-2-{[(2R,3R,4S,5S,6R)-3,4,5-trihidroxi-6-(hidroximetil)oxán-2-il]oximetil}-2H-furán-5-on
Kémiai azonosítók
CAS-szám 644-69-9
PubChem 441581
ChemSpider 390250
SMILES
C1=CC(=O)OC1COC2C(C(C(C(O2)CO)O)O)O
InChI
1/C11H16O8/c12-3-6-8(14)9(15)10(16)11(19-6)17-4-5-1-2-7(13)​18-5/h1-2,5-6,8-12,14-16H,3-4H2/t5-,6+,8+,9-,10+,11+/m0/s1
StdInChIKey TYWXNGXVSZRXNA-NVZSGMJQSA-N
Kémiai és fizikai tulajdonságok
Kémiai képlet C11H16O8
Moláris tömeg 276,24 g/mol
Olvadáspont 141–142 °C
Ha másként nem jelöljük, az adatok
az anyag standard állapotára vonatkoznak.
(25 °C, 100 kPa)

A ranunkulin a boglárkafélék családjának (Ranunculaceae) növényeiben található bomlékony glikozid. Amikor a növény megsérül, a ranunkulin enzim hatására glükózra és a protoanemonin nevű méregre bomlik.

Protoanemonin, a ranunkulin aglikonja


Fordítás[szerkesztés]

Ez a szócikk részben vagy egészben a Ranunculin című angol Wikipédia-szócikk fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel.