5-nitro-ftálhidrazid

A Wikipédiából, a szabad enciklopédiából
Ugrás a navigációhoz Ugrás a kereséshez
5-Nitro-ftálhidrazid[1][2]
165x162pt
IUPAC-név 5-nitro-2,3-dihidroftalazin-1,4-dion
Más nevek 2,3-dihidro-5-nitro-1,4-ftalazindion
Kémiai azonosítók
CAS-szám 3682-15-3
PubChem 3525223
ChemSpider 2764304
SMILES
[O-][N+](=O)c2cccc1c2C(=O)NNC1=O
InChI
InChI=1/C8H5N3O4/c12-7-4-2-1-3-5(11(14)15)6(4)8(13)10-9-7/h1-3H,(H,9,12)(H,10,13)
Kémiai és fizikai tulajdonságok
Kémiai képlet C8H5N3O4
Moláris tömeg 207,14 g/mol
Sűrűség 1,555 g/cm³
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

Az 5-nitro-ftálhidrazid 3-nitroftálsavból keletkezik köztes termékként luminol előállítása során.

Luminol synthesis.png

Forrás[szerkesztés]

  1. Sigma-Aldrich
  2. ChemSpider