Ugrás a tartalomhoz

5,7-Dihidroxitriptamin

A Wikipédiából, a szabad enciklopédiából
5,7-Dihidroxitriptamin
IUPAC-név 3-(2-Aminoetil)-1H-indol-5,7-diol
Más nevek 5,7-Dihidroxitriptamin,
5,7-DHT
Kémiai azonosítók
CAS-szám 31363-74-3
PubChem 35781
ChemSpider 32913
SMILES
Oc1cc2c(c(O)c1)[nH]cc2CCN
InChI
1/C10H12N2O2/c11-2-1-6-5-12-10-8(6)3-7(13)4-9(10)14/h3-5,12-14H,1-2,11H2
InChIKey LXWHQTNFZDTKBH-UHFFFAOYSA-N
Kémiai és fizikai tulajdonságok
Kémiai képlet C10H12N2O2
Moláris tömeg 192,214 g/mol
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

Az 5,7-dihidroxitriptamin (5,7-DHT) egy idegméreg. A tudományos kutatásban a szerotonerg idegsejtek elpusztítására használják.

Fordítás

[szerkesztés]

Ez a szócikk részben vagy egészben a(z) 5,7-Dihydroxytryptamine című angol Wikipédia-szócikk fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel. Ez a jelzés csupán a megfogalmazás eredetét és a szerzői jogokat jelzi, nem szolgál a cikkben szereplő információk forrásmegjelöléseként.