Kálium-fumarát

A Wikipédiából, a szabad enciklopédiából
Ugrás a navigációhoz Ugrás a kereséshez
Kálium-fumarát
Kémiai azonosítók
CAS-szám 17013-01-3
PubChem 6433511
SMILES
C(=CC(=O)[O-])C(=O)[O-].[K+].[K+]
Kémiai és fizikai tulajdonságok
Kémiai képlet C4H2K2O4
Moláris tömeg 192,25 g/mol
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

A kálium-fumarát a fumársav káliummal alkotott sója. Képlete: K2C4H2O4. Vízben jól oldható.

Az élelmiszeriparban savanyúságot szabályozó anyagként, E366 néven használják. Napi maximum beviteli mennyisége 6 mg/testsúlykg. Nincs ismert mellékhatása. A szervezetben lebomlik.

Elsősorban cukrászipari termékekben, pékárukban, sütőporban alkalmazzák.

Külső források[szerkesztés]