Thalidomid

A Wikipédiából, a szabad enciklopédiából
Ugrás a navigációhoz Ugrás a kereséshez
Thalidomide-2D-skeletal-wavy.svg
Thalidomid
IUPAC-név
(RS)-2-(2,6-dioxopiperidin-3-il)-1H-izoindol-1,3(2H)-dion
Kémiai azonosítók
CAS-szám 50-35-1
PubChem 5426
ChemSpider 5233
DrugBank DB01041
KEGG D00754
ATC kód L04AX02
SMILES
c1ccc2c(c1)C(=O)N(C2=O)C3CCC(=O)NC3=O
InChI
1/C13H10N2O4/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19/h1-4,9H,5-6H2,(H,14,16,17)
StdInChIKey UEJJHQNACJXSKW-UHFFFAOYSA-N
UNII 4Z8R6ORS6L
ChEMBL 468
Kémiai és fizikai tulajdonságok
Kémiai képlet C13H10N2O4
Moláris tömeg 258,23 g/mol
Farmakokinetikai adatok
Metabolizmus Hepatic (CYP2C19)
Biológiai
felezési idő
5 és 7 óra között
Fehérjekötés 55% az (+)-R, 66% az (–)-S enantiomer
Terápiás előírások
Jogi státusz receptköteles
Terhességi kategória X (US)
X (AU)
Alkalmazás szájon át

A thalidomid (INN: thalidomide) csontvelőrák és lepra elleni gyógyszer.

Az ötvenes évek végén jelent meg Nyugat-Németországban Contergan néven, mint recept nélkül kapható nyugtató. 1961-ben visszavonták, mivel súlyos fejlődési és idegrendszeri károsodást okozott. Sokan a modern idők egyik legnagyobb orvosi tragédiájának tartják.

Története[szerkesztés]

1957–1961 között sok országban forgalmazták. 1958-tól hirtelen megnőtt a végtag nélküli, illetve fejletlen végtaggal született újszülöttek száma (phocomelia). Az áldozatok számát 10–20 ezer főre becsülik. Az 1980-as években kiderült, hogy a racém formában gyártott szernek csak az egyik enantiomere okoz rendellenességet.[1] Az utóbbi idők felfedezése, hogy az emberi szervezetben az enantiomerek egymásba tudnak alakulni.[2]

A tragédia után megszigorították a gyógyszerek forgalomba hozását. Csak a hatékony enantiomer kerülhet a készítménybe,[3] és külön meg kell vizsgálni a gyógyszerek hatását terhes nőkre.

1964-ben a Jeruzsálemi Héber Egyetem kórházában felfedezték, hogy a szer javít a leprában szenvedő betegek állapotán. Azóta felújult az érdeklődés az anyag iránt. 1998-ban az FDA[4] is jóváhagyta a szer lepra elleni használatát.


1962: Frances Oldham Kelsey, az FDA[4] felügyelője díjat vesz át John F. Kennedytől a thalidomid USA-beli forgalmazásának megakadályozásáért

Forrás[szerkesztés]

Fordítás[szerkesztés]

Ez a szócikk részben vagy egészben a Thalidomide című angol Wikipédia-szócikk fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel. Ez a szócikk részben vagy egészben a Phocomelia című angol Wikipédia-szócikk fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel.

Jegyzetek[szerkesztés]

  1. Szántay Csaba: Gyógyszereink és a szimmetria Mindentudás Egyeteme, videó. A Conterganról szóló rész 9:20 és 11:00 között van. Írott változat ugyanezen a linken.
  2. Hollósi Miklós: Barangolások a kiralitás birodalmában
  3. Mindentudás Egyeteme, videó 11:00 és 12:20 között
  4. a b Food and Drug Assistance, USA, honlap.