Klobetazol-propionát

A Wikipédiából, a szabad enciklopédiából
Clobetasol propionate structure.png
Klobetazol-propionát
IUPAC-név
[17-(2'-klóracetil)- 9-fluor-11-hidroxi-10,13,16-trimetil-3-oxo-6,7,8,11,12,14,15, 16-oktahidrociklopenta[a]fenantrén-17-yl]-propanoát
Kémiai azonosítók
CAS-szám 25122-46-7
PubChem 32798
ChemSpider 30399
DrugBank APRD00876
ATC kód D07AD01
SMILES
ClCC(=O)[C@]3(OC(=O)CC)[C@]2(C[C@H](O)[C@]4(F)[C@@]/1(\C(=C/C(=O)\C=C\1)CC[C@H]4[C@@H]2C[C@@H]3C)C)C
InChI
1/C25H32ClFO5/c1-5-21(31)32-25(20(30)13-26)14(2) 10-18-17-7-6-15-11-16(28) 8-9-22(15,3)24(17,27)19(29)12-23(18,25)4/ h8-9,11,14,17-19,29H,5-7,10,12-13H2,1-4H3/ t14-,17-,18-,19-,22-,23-,24-,25-/m0/s1
Kémiai és fizikai tulajdonságok
Kémiai képlet C25H32ClFO5
Moláris tömeg 466,97 g/mol
Terápiás előírások
Terhességi kategória C (US)

A klobetazol-propionát igen erős hatású lokális kortikoszteroid (glükokortikoid). Nemspecifikus gyulladáscsökkentő hatását a bőrön vasoconstrictiót okozó és kollagén szintézist csökkentő hatása révén fejti ki.

Készítmények[szerkesztés]

Dermovate (GlaxoSmithKline)

Clobex