Ellagsav

A Wikipédiából, a szabad enciklopédiából
Ellagsav
Ellagic acid.svg
IUPAC-név 2,3,7,8-tetrahidroxikroméno[5,4,3-cde]kromén-5,10-dion
Szabályos név 6,7,13,14-tetrahidroxi-2,9-dioxatetraciklo[6.6.2.04,16.011,15]hexadeka-1(15),4,6,8(16),11,13-hexaén-3,10-dion
Kémiai azonosítók
CAS-szám 476-66-4
PubChem 16760409
ChemSpider 4445149
EINECS-szám 207-508-3
DrugBank DB08468
KEGG C10788
ChEBI 4775
RTECS szám DJ2620000
SMILES
c1c2c3c4c(cc(c(c4oc2=O)O)O)c(=O) oc3c(c1O)O
InChI
1S/C14H6O8/c15-5-1-3-7-8-4(14(20)22-11(7)9(5)17) 2-6(16)10(18)12(8)21-13(3)19/h1-2,15-18H
StdInChIKey AFSDNFLWKVMVRB-UHFFFAOYSA-N
Beilstein 47549
UNII 19YRN3ZS9P
ChEMBL 6246
Kémiai és fizikai tulajdonságok
Kémiai képlet C14H6O8
Moláris tömeg 302,19 g/mol
Megjelenés sárgás, íztelen kristályos por
Szag nincs
Olvadáspont 450 °C
Forráspont 796,5 °C
Oldhatóság (vízben) kevéssé
Oldhatóság (lúgok) erős sárgás színeződéssel oldódik
Oldhatóság (piridin) oldódik
Farmakokinetikai adatok
Metabolizmus máj
Kiválasztás vese
Veszélyek
MSDS https://www.caymanchem.com/msdss/10569m.pdf
EU osztályozás Irritatív Xi
R mondatok R36/37/38
S mondatok S22 S24/25 S26 S36/37/39
Lobbanáspont 310,11 °C
Ha másként nem jelöljük, az adatok
az anyag standard állapotára vonatkoznak.
(25 °C, 100 kPa)

Az ellagsav sárgás színű, íztelen és szagtalan kristályos por. Fényre nem érzékeny, olíva színű krómlakkot képez. A természetben a gubacsban, a bezoárkőben(en), a gránátalmában, bogyós gyümölcsökben (málna, szeder, eper) és magokban (dió, pisztácia, kesudió) fordul elő. Sok cserzőanyag alkotórésze.

Erős kazein kináz 2(en) gátló, ezáltal hatékony antioxidáns és antimutagén. Sejtburjánzás elleni hatása van: gátolja bizonyos rákkeltő anyagok miatt kialakult daganatok növekedését. Gátolja a két topoizomerázt(en),[1] a protein kináz C-t(en), a glutation S-transferázt(en)[2] és számos más enzimet is. Hátránya, hogy alacsony a biohasznosíthatósága(en) (a hámsejtekben koncentrálódik, kis mennyiségben jut a vérkeringésbe) és rövid a felezési ideje.[3] A kevés vérkeringésbe jutó ellagsav a bélben punikalaginból(en) keletkezik hidrolízis során.

Galluszsav mérsékelt oxidációjával állítható elő.

Felhasználás: pácfesték, béladsztringens,[4] hemosztiptikum.[5] Mellrák elleni hasznosíthatóságát jelenleg is kutatják.

Dél-koreai kutatók kimutatták, hogy védi a bőrt az UV-B sugárzás ellen.[6]

Jegyzetek[szerkesztés]

  1. A Constantinou, G D Stoner, R Mehta, K Rao, C Runyan, R Moon: The dietary anticancer agent ellagic acid is a potent inhibitor of DNA topoisomerases in vitro. (Sigma-Aldrich)
  2. M Das, D R Bickers, H Mukhtar: Plant phenols as in vitro inhibitors of glutathione S-transferase(s). (Sigma-Aldrich)
  3. Larrosa M, García-Conesa MT, Espín JC, Tomás-Barberán FA.: Ellagitannins, ellagic acid and vascular health. (PubMed)
  4. Béladsztringens: a bél szöveteit összehúzó, ezáltal gyulladásgátló és vérzéscsillapító anyag.
  5. Hemosztiptikum: a véralvadás gyorsításával ható vérzéscsillapító anyag.
  6. David Bradley: Berries beat UV-B (spectroscopyNOW.com)

Források[szerkesztés]

További információk[szerkesztés]

Kapcsolódó szócikkek[szerkesztés]