Ambroxol

A Wikipédiából, a szabad enciklopédiából
Ambroxol structural formulae.png
Ambroxol
IUPAC-név
transz-4-(2-amino-3,5-dibrómbenzilamino)-ciklohexanol
Kémiai azonosítók
CAS-szám 18683-91-5
PubChem 2132
ATC kód R05CB06
Gyógyszer szabadnév ambroxol
Gyógyszerkönyvi név Ambroxoli hydrochloridum
SMILES
O[C@H]2CC[C@H](NCc1cc(Br)cc(Br)c1N)CC2
Kémiai és fizikai tulajdonságok
Kémiai képlet C13H18Br2N2O
Moláris tömeg 378,10 g/mol

Az ambroxol, a brómhexin metabolitja, benzil-amin szerkezetű mukolitikum.

Gyógyszerhatás[szerkesztés]

Hatására a nyákelválasztó sejtekben fokozódik a lizoszómák képződése és a hidrolitikus enzimek aktivitása, ami a bronchiális váladék savanyú mukopoliszacharidákból álló rostjainak lebontásához vezet. Egyúttal a szerózus mirigysejtek stimulálódnak, így kisebb viszkozitású nyák képződik. A légutak gyulladásos megbetegedéseiben az ambroxol fokozza a surfactantképződést.

Az ambroxol csaknem teljes mértékben felszívódik és 80%-ban plazmafehérjékhez kötődik. „First-pass” effektussal metabolizálódik, majd inaktív metabolit formájában túlnyomó részben (90%) a vesén keresztül választódik ki.

Állatkísérletes vizsgálatok szerint az ambroxol átjut a méhlepényen, kiválasztódik az anyatejbe és az agy-gerincvelői folyadékban is kimutatható.