5-metiluridin

A Wikipédiából, a szabad enciklopédiából
Ugrás a navigációhoz Ugrás a kereséshez
5-metiluridin
az 5-metiluridin szerkezeti képlete
az 5-metiluridin molekula kalottamodellje
IUPAC-név 1-[(2R,3R,4S,5R)-3,4-dihidroxi-5-(hidroximetil)oxolán-2-il]-5-metilpirimidin-2,4-dion
Más nevek ribotimidin, riboziltimin, timin ribozid, m5U
Kémiai azonosítók
CAS-szám 1463-10-1
PubChem 445408
ChemSpider 393058
SMILES
CC1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O
InChI
1/C10H14N2O6/c1-4-2-12(10(17)11-8(4)16)9-7(15)6(14)5(3-13)18-9/h2,5-7,9,13-15H,3H2,1H3,(H,11,16,17)/t5-,6-,7-,9-/m1/s1
StdInChIKey DWRXFEITVBNRMK-JXOAFFINSA-N
Kémiai és fizikai tulajdonságok
Kémiai képlet C10H14N2O6
Moláris tömeg 258,23 g/mol
Megjelenés fehér, kristályos por
Sűrűség 1,6 g/cm3[1]
Olvadáspont 184 °C[2]
Ha másként nem jelöljük, az adatok az anyag standardállapotára (100 kPa) és 25 °C-os hőmérsékletre vonatkoznak.

Az 5-metiluridin egy pirimidin nukleozid, amely timinmolekulából és a hozzá β-N1-glikozidos kötéssel kapcsolódó ribózgyűrűből (ribofuranóz) áll. Ha az 5-metiluridin ribózgyűrűje meg van fosztva a C2 pozíciónál található hidroxilcsoporttól, akkor a kapott vegyületet timidinnek hívjuk, amely egy dezoxinukleozid.

Az 5-metiluridin külső megjelenésre fehér, kristályos por, amely standard hőmérsékleten és nyomáson (STP) nagyon stabil.


Források[szerkesztés]

  1. 5-Methyluridine. ChemSpider
  2. William M. Haynes. CRC Handbook of Chemistry and Physics, 97th edition, Boca Raton: CRC Press, 3-400. o. (2016). ISBN 978-1-4987-5429-3 

Fordítás[szerkesztés]

Ez a szócikk részben vagy egészben a(z) 5-methyluridine című angol Wikipédia-szócikk ezen változatának fordításán alapul. Az eredeti cikk szerkesztőit annak laptörténete sorolja fel.